|
|
Build Your Online Product Catalogs?
| Product Name: |
Piperonyl Methyl Ketone
|
| Supply Ability: |
20ton |
| Related proudcts |
piperonyl methyl ket, pmk, 4676-39-5, |
| Specifications |
99% |
| Price Term: |
fob |
| Port of loading: |
shangghai ningbo |
| Minimum Order |
25kg |
| Unit Price: |
1-300usd/kg |
|
Name: 3,4-(methylenedioxy)phenylpropan-2-one
Other name: 3,4-Methylenedioxyphenylacetone; 1,3-benzodioxol-5-ylpropan-2-one; Piperonyl methyl ketone; 1-(1,3-benzodioxol-5-yl)propan-2-one
CAS: 4676-39-5
EINEC: 225-128-6
MF: C10H10O3
M.W.: 178.1846
InChI: InChI=1/C10H10O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5H,4,6H2,1H3
Density:1.211g/cm3
Boiling point: 275.9℃ at 760 mmHg
Flash point: 111.4℃
Vapour pressure:0.00495mmHg at 25℃
Apperance: oil light yellow liquid
Application: Pharmaceutical intermediates for the synthesis of antibacterial fire berberine cardiovascular sinistral methyldopa antihypertensive drugs and anti-tumor drugs, etc.
|
| Company: |
dingxin sunrise chemical tadre co.ltd
|
| Contact: |
Mr. to sun |
| Address: |
zhangyang road |
| Postcode: |
021000 |
| Tel: |
86-021-55556807 |
| Fax: |
86-021-55556808 |
| E-mail: |
|
|
|
|
Home
